About 3,4-dimethyl-2,5-dimethylidenethiophene
3,4-dimethyl-2,5-dimethylidenethiophene (PubChem CID 59775905) has the molecular formula C8H10S
and a molecular weight of 138.23 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-dimethylidenethiophene.
Molecular Properties
| Compound Name | 3,4-dimethyl-2,5-dimethylidenethiophene |
| PubChem CID | 59775905 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 3,4-dimethyl-2,5-dimethylidenethiophene |
| SMILES | C=c1sc(=C)c(C)c1C |
| InChI | InChI=1S/C8H10S/c1-5-6(2)8(4)9-7(5)3/h3-4H2,1-2H3 |
| InChIKey | DENXRGKYPKIXSI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethyl-2,5-dimethylidenethiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2,5-dimethylidenethiophene?
The IUPAC name of 3,4-dimethyl-2,5-dimethylidenethiophene (CID 59775905) is 3,4-dimethyl-2,5-dimethylidenethiophene.
What is the SMILES notation for 3,4-dimethyl-2,5-dimethylidenethiophene?
The canonical SMILES for 3,4-dimethyl-2,5-dimethylidenethiophene is C=c1sc(=C)c(C)c1C.
What is the InChIKey of 3,4-dimethyl-2,5-dimethylidenethiophene?
The InChIKey is DENXRGKYPKIXSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S/c1-5-6(2)8(4)9-7(5)3/h3-4H2,1-2H3.
What are the key properties of 3,4-dimethyl-2,5-dimethylidenethiophene?
3,4-dimethyl-2,5-dimethylidenethiophene has a molecular weight of 138.23 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,5-dimethylidenethiophene is sourced from PubChem (CID 59775905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).