About 2-ethyl-1,3-dimethylcyclobutane;yttrium
2-ethyl-1,3-dimethylcyclobutane;yttrium (PubChem CID 59776218) has the molecular formula C8H15Y-
and a molecular weight of 200.11 g/mol. Its IUPAC name is 2-ethyl-1,3-dimethylcyclobutane;yttrium.
Molecular Properties
| Compound Name | 2-ethyl-1,3-dimethylcyclobutane;yttrium |
| PubChem CID | 59776218 |
| Molecular Formula | C8H15Y- |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 2-ethyl-1,3-dimethylcyclobutane;yttrium |
| SMILES | CCC1C(C)[CH-]C1C.[Y] |
| InChI | InChI=1S/C8H15.Y/c1-4-8-6(2)5-7(8)3;/h5-8H,4H2,1-3H3;/q-1; |
| InChIKey | SHUMRSJJOVDHAJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1,3-dimethylcyclobutane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3-dimethylcyclobutane;yttrium?
The IUPAC name of 2-ethyl-1,3-dimethylcyclobutane;yttrium (CID 59776218) is 2-ethyl-1,3-dimethylcyclobutane;yttrium.
What is the SMILES notation for 2-ethyl-1,3-dimethylcyclobutane;yttrium?
The canonical SMILES for 2-ethyl-1,3-dimethylcyclobutane;yttrium is CCC1C(C)[CH-]C1C.[Y].
What is the InChIKey of 2-ethyl-1,3-dimethylcyclobutane;yttrium?
The InChIKey is SHUMRSJJOVDHAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15.Y/c1-4-8-6(2)5-7(8)3;/h5-8H,4H2,1-3H3;/q-1;.
What are the key properties of 2-ethyl-1,3-dimethylcyclobutane;yttrium?
2-ethyl-1,3-dimethylcyclobutane;yttrium has a molecular weight of 200.11 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3-dimethylcyclobutane;yttrium is sourced from PubChem (CID 59776218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).