About 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone
1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone (PubChem CID 59776993) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone |
| PubChem CID | 59776993 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone |
| SMILES | [H]/N=c1\sc2cc(O)ccc2n1C(C)=O |
| InChI | InChI=1S/C9H8N2O2S/c1-5(12)11-7-3-2-6(13)4-8(7)14-9(11)10/h2-4,10,13H,1H3/b10-9- |
| InChIKey | TXRNCSGCLUMIJD-KTKRTIGZSA-N |
| XLogP | 1.55 |
| TPSA | 66.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone?
The IUPAC name of 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone (CID 59776993) is 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone.
What is the SMILES notation for 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone?
The canonical SMILES for 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone is [H]/N=c1\sc2cc(O)ccc2n1C(C)=O.
What is the InChIKey of 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone?
The InChIKey is TXRNCSGCLUMIJD-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H8N2O2S/c1-5(12)11-7-3-2-6(13)4-8(7)14-9(11)10/h2-4,10,13H,1H3/b10-9-.
What are the key properties of 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone?
1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone has a molecular weight of 208.24 g/mol, XLogP of 1.55, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-hydroxy-2-imino-1,3-benzothiazol-3-yl)ethanone is sourced from PubChem (CID 59776993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).