C19H22N2O3S — CID 59777072
5-[(E)-3-(dimethylamino)prop-2-enoyl]-N-[2-(3-methoxyphenyl)ethyl]thiophene-2-carboxamide (PubChem CID 59777072) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is 5-[(E)-3-(dimethylamino)prop-2-enoyl]-N-[2-(3-methoxyphenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-[(E)-3-(dimethylamino)prop-2-enoyl]-N-[2-(3-methoxyphenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59777072 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5-[(E)-3-(dimethylamino)prop-2-enoyl]-N-[2-(3-methoxyphenyl)ethyl]thiophene-2-carboxamide |
| SMILES | COc1cccc(CCNC(=O)c2ccc(C(=O)/C=C/N(C)C)s2)c1 |
| InChI | InChI=1S/C19H22N2O3S/c1-21(2)12-10-16(22)17-7-8-18(25-17)19(23)20-11-9-14-5-4-6-15(13-14)24-3/h4-8,10,12-13H,9,11H2,1-3H3,(H,20,23)/b12-10+ |
| InChIKey | GURBYHZEVISAPF-ZRDIBKRKSA-N |
| XLogP | 2.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|