C21H15ClN6O4S2 — CID 59777577
1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(2,4-dioxo-1H-quinazolin-3-yl)-3-isocyanophenyl]-2-methylguanidine (PubChem CID 59777577) has the molecular formula C21H15ClN6O4S2 and a molecular weight of 514.98 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(2,4-dioxo-1H-quinazolin-3-yl)-3-isocyanophenyl]-2-methylguanidine.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(2,4-dioxo-1H-quinazolin-3-yl)-3-isocyanophenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 59777577 |
| Molecular Formula | C21H15ClN6O4S2 |
| Molecular Weight | 514.98 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-(2,4-dioxo-1H-quinazolin-3-yl)-3-isocyanophenyl]-2-methylguanidine |
| SMILES | [C-]#[N+]c1cc(N/C(=N/C)NS(=O)(=O)c2ccc(Cl)s2)ccc1-n1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C21H15ClN6O4S2/c1-23-15-11-12(25-20(24-2)27-34(31,32)18-10-9-17(22)33-18)7-8-16(15)28-19(29)13-5-3-4-6-14(13)26-21(28)30/h3-11H,2H3,(H,26,30)(H2,24,25,27) |
| InChIKey | GMPQXESEWZNJML-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.98 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|