C29H38F3N5O2 — CID 59777685
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[3-(4-methylpiperazin-1-yl)propyl]urea (PubChem CID 59777685) has the molecular formula C29H38F3N5O2 and a molecular weight of 545.65 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[3-(4-methylpiperazin-1-yl)propyl]urea.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[3-(4-methylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 59777685 |
| Molecular Formula | C29H38F3N5O2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[3-(4-methylpiperazin-1-yl)propyl]urea |
| SMILES | CN1CCN(CCCNC(=O)NC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C29H38F3N5O2/c1-36-14-16-37(17-15-36)13-5-12-33-28(38)34-19-22-9-10-23-26(20-6-3-2-4-7-20)35-25-11-8-21(29(30,31)32)18-24(25)27(23)39-22/h2-4,6-8,11,18,22-23,26-27,35H,5,9-10,12-17,19H2,1H3,(H2,33,34,38)/t22-,23+,26+,27+/m1/s1 |
| InChIKey | JAVSCBGNNVPWBM-DTBHQADXSA-N |
| XLogP | 4.65 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|