C34H33F3N2O — CID 59777701
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1,2-diphenylethanamine (PubChem CID 59777701) has the molecular formula C34H33F3N2O and a molecular weight of 542.65 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1,2-diphenylethanamine.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 59777701 |
| Molecular Formula | C34H33F3N2O |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1,2-diphenylethanamine |
| SMILES | FC(F)(F)c1ccc2c(c1)[C@H]1O[C@@H](CNC(Cc3ccccc3)c3ccccc3)CC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C34H33F3N2O/c35-34(36,37)26-16-19-30-29(21-26)33-28(32(39-30)25-14-8-3-9-15-25)18-17-27(40-33)22-38-31(24-12-6-2-7-13-24)20-23-10-4-1-5-11-23/h1-16,19,21,27-28,31-33,38-39H,17-18,20,22H2/t27-,28+,31?,32+,33+/m1/s1 |
| InChIKey | HNKHMKPPERLLFZ-BAHVDFDNSA-N |
| XLogP | 8.28 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |