C27H34F3N5O2 — CID 59777707
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-piperazin-1-ylethyl)urea (PubChem CID 59777707) has the molecular formula C27H34F3N5O2 and a molecular weight of 517.60 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-piperazin-1-ylethyl)urea.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 59777707 |
| Molecular Formula | C27H34F3N5O2 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-piperazin-1-ylethyl)urea |
| SMILES | O=C(NCCN1CCNCC1)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H34F3N5O2/c28-27(29,30)19-6-9-23-22(16-19)25-21(24(34-23)18-4-2-1-3-5-18)8-7-20(37-25)17-33-26(36)32-12-15-35-13-10-31-11-14-35/h1-6,9,16,20-21,24-25,31,34H,7-8,10-15,17H2,(H2,32,33,36)/t20-,21+,24+,25+/m1/s1 |
| InChIKey | AZGVLVFIJMFFNN-QKYMMTCKSA-N |
| XLogP | 3.91 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |