C29H38F4N4O2 — CID 59777708
2-[4-[3-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]piperazin-1-yl]ethanol (PubChem CID 59777708) has the molecular formula C29H38F4N4O2 and a molecular weight of 550.64 g/mol. Its IUPAC name is 2-[4-[3-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[3-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 59777708 |
| Molecular Formula | C29H38F4N4O2 |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 2-[4-[3-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(CCCNC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H38F4N4O2/c30-22-5-2-20(3-6-22)27-24-8-7-23(19-34-10-1-11-36-12-14-37(15-13-36)16-17-38)39-28(24)25-18-21(29(31,32)33)4-9-26(25)35-27/h2-6,9,18,23-24,27-28,34-35,38H,1,7-8,10-17,19H2/t23-,24+,27+,28+/m1/s1 |
| InChIKey | UECJYLORQIRMGO-JGPKDBRGSA-N |
| XLogP | 4.44 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|