C15H14BrFN2 — CID 59777719
(2R)-6-bromo-8-fluoro-2-phenyl-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 59777719) has the molecular formula C15H14BrFN2 and a molecular weight of 321.19 g/mol. Its IUPAC name is (2R)-6-bromo-8-fluoro-2-phenyl-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | (2R)-6-bromo-8-fluoro-2-phenyl-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 59777719 |
| Molecular Formula | C15H14BrFN2 |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | (2R)-6-bromo-8-fluoro-2-phenyl-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | NC1C[C@H](c2ccccc2)Nc2c(F)cc(Br)cc21 |
| InChI | InChI=1S/C15H14BrFN2/c16-10-6-11-13(18)8-14(9-4-2-1-3-5-9)19-15(11)12(17)7-10/h1-7,13-14,19H,8,18H2/t13?,14-/m1/s1 |
| InChIKey | RQJRMLNJOZJCJH-ARLHGKGLSA-N |
| XLogP | 4.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |