C27H34F3N3O2 — CID 59777733
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-5-(dimethylamino)pentanamide (PubChem CID 59777733) has the molecular formula C27H34F3N3O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-5-(dimethylamino)pentanamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-5-(dimethylamino)pentanamide |
|---|---|
| PubChem CID | 59777733 |
| Molecular Formula | C27H34F3N3O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-5-(dimethylamino)pentanamide |
| SMILES | CN(C)CCCCC(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H34F3N3O2/c1-33(2)15-7-6-10-24(34)31-17-20-12-13-21-25(18-8-4-3-5-9-18)32-23-14-11-19(27(28,29)30)16-22(23)26(21)35-20/h3-5,8-9,11,14,16,20-21,25-26,32H,6-7,10,12-13,15,17H2,1-2H3,(H,31,34)/t20-,21+,25+,26+/m1/s1 |
| InChIKey | IZLMJSVWGUWTHY-SYUUKGODSA-N |
| XLogP | 5.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|