C26H32F3N3O3S — CID 59777748
(2R,4aS,5R,10bS)-2-[(4-ethylsulfonylpiperazin-1-yl)methyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 59777748) has the molecular formula C26H32F3N3O3S and a molecular weight of 523.62 g/mol. Its IUPAC name is (2R,4aS,5R,10bS)-2-[(4-ethylsulfonylpiperazin-1-yl)methyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (2R,4aS,5R,10bS)-2-[(4-ethylsulfonylpiperazin-1-yl)methyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 59777748 |
| Molecular Formula | C26H32F3N3O3S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | (2R,4aS,5R,10bS)-2-[(4-ethylsulfonylpiperazin-1-yl)methyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CCS(=O)(=O)N1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32F3N3O3S/c1-2-36(33,34)32-14-12-31(13-15-32)17-20-9-10-21-24(18-6-4-3-5-7-18)30-23-11-8-19(26(27,28)29)16-22(23)25(21)35-20/h3-8,11,16,20-21,24-25,30H,2,9-10,12-15,17H2,1H3/t20-,21+,24+,25+/m1/s1 |
| InChIKey | MWXGLYOYIKRUCA-QKYMMTCKSA-N |
| XLogP | 4.68 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |