C27H35F3N4O3S — CID 59777759
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-(4-methylpiperazin-1-yl)ethanesulfonamide (PubChem CID 59777759) has the molecular formula C27H35F3N4O3S and a molecular weight of 552.66 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-(4-methylpiperazin-1-yl)ethanesulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-(4-methylpiperazin-1-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 59777759 |
| Molecular Formula | C27H35F3N4O3S |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-(4-methylpiperazin-1-yl)ethanesulfonamide |
| SMILES | CN1CCN(CCS(=O)(=O)NC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C27H35F3N4O3S/c1-33-11-13-34(14-12-33)15-16-38(35,36)31-18-21-8-9-22-25(19-5-3-2-4-6-19)32-24-10-7-20(27(28,29)30)17-23(24)26(22)37-21/h2-7,10,17,21-22,25-26,31-32H,8-9,11-16,18H2,1H3/t21-,22+,25+,26+/m1/s1 |
| InChIKey | ZJKJGGAVDMGROL-HRHCJDDBSA-N |
| XLogP | 3.88 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |