C32H36F3N3O3 — CID 59777763
[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl N-benzyl-N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 59777763) has the molecular formula C32H36F3N3O3 and a molecular weight of 567.65 g/mol. Its IUPAC name is [(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl N-benzyl-N-[2-(dimethylamino)ethyl]carbamate.
| Compound Name | [(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl N-benzyl-N-[2-(dimethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 59777763 |
| Molecular Formula | C32H36F3N3O3 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | [(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl N-benzyl-N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | CN(C)CCN(Cc1ccccc1)C(=O)OC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C32H36F3N3O3/c1-37(2)17-18-38(20-22-9-5-3-6-10-22)31(39)40-21-25-14-15-26-29(23-11-7-4-8-12-23)36-28-16-13-24(32(33,34)35)19-27(28)30(26)41-25/h3-13,16,19,25-26,29-30,36H,14-15,17-18,20-21H2,1-2H3/t25-,26+,29+,30+/m1/s1 |
| InChIKey | UWIYLOQDIHJCPH-UUHGVMMKSA-N |
| XLogP | 6.91 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |