C26H31F4N3O2 — CID 59777784
2-[4-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-1-yl]ethanol (PubChem CID 59777784) has the molecular formula C26H31F4N3O2 and a molecular weight of 493.55 g/mol. Its IUPAC name is 2-[4-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 59777784 |
| Molecular Formula | C26H31F4N3O2 |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 2-[4-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H31F4N3O2/c27-19-4-1-17(2-5-19)24-21-7-6-20(16-33-11-9-32(10-12-33)13-14-34)35-25(21)22-15-18(26(28,29)30)3-8-23(22)31-24/h1-5,8,15,20-21,24-25,31,34H,6-7,9-14,16H2/t20-,21+,24+,25+/m1/s1 |
| InChIKey | VLRPNWVHGIECNB-QKYMMTCKSA-N |
| XLogP | 4.46 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |