C26H31F3N4O2 — CID 59777796
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-methylpiperazine-1-carboxamide (PubChem CID 59777796) has the molecular formula C26H31F3N4O2 and a molecular weight of 488.55 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59777796 |
| Molecular Formula | C26H31F3N4O2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-methylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)NC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31F3N4O2/c1-32-11-13-33(14-12-32)25(34)30-16-19-8-9-20-23(17-5-3-2-4-6-17)31-22-10-7-18(26(27,28)29)15-21(22)24(20)35-19/h2-7,10,15,19-20,23-24,31H,8-9,11-14,16H2,1H3,(H,30,34)/t19-,20+,23+,24+/m1/s1 |
| InChIKey | LGQQRWABSMRGAY-SHBJFUFKSA-N |
| XLogP | 4.67 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |