C29H37F4N3O — CID 59777798
N-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 59777798) has the molecular formula C29H37F4N3O and a molecular weight of 519.63 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 59777798 |
| Molecular Formula | C29H37F4N3O |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CC1(C)CC(NC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccc(F)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C29H37F4N3O/c1-27(2)14-20(15-28(3,4)36-27)34-16-21-10-11-22-25(17-5-8-19(30)9-6-17)35-24-12-7-18(29(31,32)33)13-23(24)26(22)37-21/h5-9,12-13,20-22,25-26,34-36H,10-11,14-16H2,1-4H3/t21-,22+,25+,26+/m1/s1 |
| InChIKey | OIIMCZVBHHXHMD-HRHCJDDBSA-N |
| XLogP | 6.75 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |