C27H32F3N3O4 — CID 59777834
tert-butyl N-[2-[[(2S,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-2-carbonyl]amino]ethyl]carbamate (PubChem CID 59777834) has the molecular formula C27H32F3N3O4 and a molecular weight of 519.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2S,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-2-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2S,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-2-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 59777834 |
| Molecular Formula | C27H32F3N3O4 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | tert-butyl N-[2-[[(2S,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-2-carbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)[C@@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H32F3N3O4/c1-26(2,3)37-25(35)32-14-13-31-24(34)21-12-10-18-22(16-7-5-4-6-8-16)33-20-11-9-17(27(28,29)30)15-19(20)23(18)36-21/h4-9,11,15,18,21-23,33H,10,12-14H2,1-3H3,(H,31,34)(H,32,35)/t18-,21-,22-,23-/m0/s1 |
| InChIKey | LFMSNZJDDZWLBY-QGQQZZQASA-N |
| XLogP | 5.35 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|