C24H28F4N2O3 — CID 59777838
2-[2-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethoxy]ethanol (PubChem CID 59777838) has the molecular formula C24H28F4N2O3 and a molecular weight of 468.49 g/mol. Its IUPAC name is 2-[2-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 59777838 |
| Molecular Formula | C24H28F4N2O3 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 2-[2-[[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethoxy]ethanol |
| SMILES | OCCOCCNC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C24H28F4N2O3/c25-17-4-1-15(2-5-17)22-19-7-6-18(14-29-9-11-32-12-10-31)33-23(19)20-13-16(24(26,27)28)3-8-21(20)30-22/h1-5,8,13,18-19,22-23,29-31H,6-7,9-12,14H2/t18-,19+,22+,23+/m1/s1 |
| InChIKey | GAWMEZKVYVPZDU-FUKQBSRTSA-N |
| XLogP | 4.45 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|