C27H29F3N4O2 — CID 59777864
N-[2-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]imidazol-4-yl]ethyl]acetamide (PubChem CID 59777864) has the molecular formula C27H29F3N4O2 and a molecular weight of 498.55 g/mol. Its IUPAC name is N-[2-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]imidazol-4-yl]ethyl]acetamide.
| Compound Name | N-[2-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]imidazol-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 59777864 |
| Molecular Formula | C27H29F3N4O2 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | N-[2-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]imidazol-4-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1cncn1C[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H29F3N4O2/c1-17(35)32-12-11-20-14-31-16-34(20)15-21-8-9-22-25(18-5-3-2-4-6-18)33-24-10-7-19(27(28,29)30)13-23(24)26(22)36-21/h2-7,10,13-14,16,21-22,25-26,33H,8-9,11-12,15H2,1H3,(H,32,35)/t21-,22+,25+,26+/m1/s1 |
| InChIKey | RNIFLWDFYPLNQI-HRHCJDDBSA-N |
| XLogP | 5.28 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |