C25H29F4N3O — CID 59777867
(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 59777867) has the molecular formula C25H29F4N3O and a molecular weight of 463.52 g/mol. Its IUPAC name is (2R,4aS,5R,10bS)-5-(4-fluorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (2R,4aS,5R,10bS)-5-(4-fluorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 59777867 |
| Molecular Formula | C25H29F4N3O |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | (2R,4aS,5R,10bS)-5-(4-fluorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CN1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H29F4N3O/c1-31-10-12-32(13-11-31)15-19-7-8-20-23(16-2-5-18(26)6-3-16)30-22-9-4-17(25(27,28)29)14-21(22)24(20)33-19/h2-6,9,14,19-20,23-24,30H,7-8,10-13,15H2,1H3/t19-,20+,23+,24+/m1/s1 |
| InChIKey | IDLIDVGKQLLNIH-SHBJFUFKSA-N |
| XLogP | 5.09 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |