C33H37F3N2O4 — CID 59777889
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(3,4-dimethoxyphenyl)piperidin-4-ol (PubChem CID 59777889) has the molecular formula C33H37F3N2O4 and a molecular weight of 582.66 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(3,4-dimethoxyphenyl)piperidin-4-ol.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(3,4-dimethoxyphenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 59777889 |
| Molecular Formula | C33H37F3N2O4 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(3,4-dimethoxyphenyl)piperidin-4-ol |
| SMILES | COc1ccc(C2(O)CCN(C[C@H]3CC[C@@H]4[C@H](O3)c3cc(C(F)(F)F)ccc3N[C@H]4c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C33H37F3N2O4/c1-40-28-13-9-22(19-29(28)41-2)32(39)14-16-38(17-15-32)20-24-10-11-25-30(21-6-4-3-5-7-21)37-27-12-8-23(33(34,35)36)18-26(27)31(25)42-24/h3-9,12-13,18-19,24-25,30-31,37,39H,10-11,14-17,20H2,1-2H3/t24-,25+,30+,31+/m1/s1 |
| InChIKey | AMEMXIHMILLTDQ-OPGKSTGDSA-N |
| XLogP | 6.71 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |