C31H39F3N4O4 — CID 59777892
tert-butyl 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]piperidine-1-carboxylate (PubChem CID 59777892) has the molecular formula C31H39F3N4O4 and a molecular weight of 588.67 g/mol. Its IUPAC name is tert-butyl 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59777892 |
| Molecular Formula | C31H39F3N4O4 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | tert-butyl 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)NC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C31H39F3N4O4/c1-30(2,3)42-29(40)38-15-13-21(14-16-38)36-28(39)35-18-22-10-11-23-26(19-7-5-4-6-8-19)37-25-12-9-20(31(32,33)34)17-24(25)27(23)41-22/h4-9,12,17,21-23,26-27,37H,10-11,13-16,18H2,1-3H3,(H2,35,36,39)/t22-,23+,26+,27+/m1/s1 |
| InChIKey | BXHOMQQDKHJLPA-DTBHQADXSA-N |
| XLogP | 6.41 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |