C34H40F3N3O2 — CID 59777909
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(4-methoxyphenyl)-N,N-dimethylpiperidin-4-amine (PubChem CID 59777909) has the molecular formula C34H40F3N3O2 and a molecular weight of 579.71 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(4-methoxyphenyl)-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(4-methoxyphenyl)-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 59777909 |
| Molecular Formula | C34H40F3N3O2 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-(4-methoxyphenyl)-N,N-dimethylpiperidin-4-amine |
| SMILES | COc1ccc(C2(N(C)C)CCN(C[C@H]3CC[C@@H]4[C@H](O3)c3cc(C(F)(F)F)ccc3N[C@H]4c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C34H40F3N3O2/c1-39(2)33(24-9-12-26(41-3)13-10-24)17-19-40(20-18-33)22-27-14-15-28-31(23-7-5-4-6-8-23)38-30-16-11-25(34(35,36)37)21-29(30)32(28)42-27/h4-13,16,21,27-28,31-32,38H,14-15,17-20,22H2,1-3H3/t27-,28+,31+,32+/m1/s1 |
| InChIKey | SSKLXDQFEJVGHR-RMVGYSHESA-N |
| XLogP | 7.27 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |