C29H37F3N4O4 — CID 59777925
tert-butyl N-[2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]ethyl]-N-methylcarbamate (PubChem CID 59777925) has the molecular formula C29H37F3N4O4 and a molecular weight of 562.63 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59777925 |
| Molecular Formula | C29H37F3N4O4 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | tert-butyl N-[2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCNC(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H37F3N4O4/c1-28(2,3)40-27(38)36(4)15-14-33-26(37)34-17-20-11-12-21-24(18-8-6-5-7-9-18)35-23-13-10-19(29(30,31)32)16-22(23)25(21)39-20/h5-10,13,16,20-21,24-25,35H,11-12,14-15,17H2,1-4H3,(H2,33,34,37)/t20-,21+,24+,25+/m1/s1 |
| InChIKey | MNGYMWHHBFYSHK-QKYMMTCKSA-N |
| XLogP | 5.87 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |