C28H37F3N4O3S — CID 59777926
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(4-methylpiperazin-1-yl)propane-1-sulfonamide (PubChem CID 59777926) has the molecular formula C28H37F3N4O3S and a molecular weight of 566.69 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(4-methylpiperazin-1-yl)propane-1-sulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(4-methylpiperazin-1-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 59777926 |
| Molecular Formula | C28H37F3N4O3S |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(4-methylpiperazin-1-yl)propane-1-sulfonamide |
| SMILES | CN1CCN(CCCS(=O)(=O)NC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C28H37F3N4O3S/c1-34-13-15-35(16-14-34)12-5-17-39(36,37)32-19-22-9-10-23-26(20-6-3-2-4-7-20)33-25-11-8-21(28(29,30)31)18-24(25)27(23)38-22/h2-4,6-8,11,18,22-23,26-27,32-33H,5,9-10,12-17,19H2,1H3/t22-,23+,26+,27+/m1/s1 |
| InChIKey | RRVFJMAGIOEQRP-DTBHQADXSA-N |
| XLogP | 4.27 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |