C26H33F3N4O2 — CID 59777935
3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-[2-(dimethylamino)ethyl]-1-methylurea (PubChem CID 59777935) has the molecular formula C26H33F3N4O2 and a molecular weight of 490.57 g/mol. Its IUPAC name is 3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-[2-(dimethylamino)ethyl]-1-methylurea.
| Compound Name | 3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-[2-(dimethylamino)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 59777935 |
| Molecular Formula | C26H33F3N4O2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-[2-(dimethylamino)ethyl]-1-methylurea |
| SMILES | CN(C)CCN(C)C(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C26H33F3N4O2/c1-32(2)13-14-33(3)25(34)30-16-19-10-11-20-23(17-7-5-4-6-8-17)31-22-12-9-18(26(27,28)29)15-21(22)24(20)35-19/h4-9,12,15,19-20,23-24,31H,10-11,13-14,16H2,1-3H3,(H,30,34)/t19-,20+,23+,24+/m1/s1 |
| InChIKey | FRVUWIVLQZKOPF-SHBJFUFKSA-N |
| XLogP | 4.91 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |