C32H36F3N3O — CID 59777970
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-phenyl-2-pyrrolidin-1-ylethanamine (PubChem CID 59777970) has the molecular formula C32H36F3N3O and a molecular weight of 535.65 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-phenyl-2-pyrrolidin-1-ylethanamine.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-phenyl-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 59777970 |
| Molecular Formula | C32H36F3N3O |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-phenyl-2-pyrrolidin-1-ylethanamine |
| SMILES | FC(F)(F)c1ccc2c(c1)[C@H]1O[C@@H](CNC(CN3CCCC3)c3ccccc3)CC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C32H36F3N3O/c33-32(34,35)24-13-16-28-27(19-24)31-26(30(37-28)23-11-5-2-6-12-23)15-14-25(39-31)20-36-29(21-38-17-7-8-18-38)22-9-3-1-4-10-22/h1-6,9-13,16,19,25-26,29-31,36-37H,7-8,14-15,17-18,20-21H2/t25-,26+,29?,30+,31+/m1/s1 |
| InChIKey | WAMICBISCLKNHR-WEMLLBPDSA-N |
| XLogP | 7.14 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |