C32H35F4N3O — CID 59778019
(3S)-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-amine (PubChem CID 59778019) has the molecular formula C32H35F4N3O and a molecular weight of 553.64 g/mol. Its IUPAC name is (3S)-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-amine.
| Compound Name | (3S)-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 59778019 |
| Molecular Formula | C32H35F4N3O |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | (3S)-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-amine |
| SMILES | Fc1ccc(CCN2CC[C@H](NC[C@H]3CC[C@@H]4[C@H](O3)c3cc(C(F)(F)F)ccc3N[C@H]4c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C32H35F4N3O/c33-24-9-6-21(7-10-24)14-16-39-17-15-25(20-39)37-19-26-11-12-27-30(22-4-2-1-3-5-22)38-29-13-8-23(32(34,35)36)18-28(29)31(27)40-26/h1-10,13,18,25-27,30-31,37-38H,11-12,14-17,19-20H2/t25-,26+,27-,30-,31-/m0/s1 |
| InChIKey | BCFJLNUIKKPTBT-MJBQOYBXSA-N |
| XLogP | 6.75 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |