C31H34F3N3O — CID 59778024
(3S)-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-benzylpyrrolidin-3-amine (PubChem CID 59778024) has the molecular formula C31H34F3N3O and a molecular weight of 521.63 g/mol. Its IUPAC name is (3S)-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-benzylpyrrolidin-3-amine.
| Compound Name | (3S)-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-benzylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 59778024 |
| Molecular Formula | C31H34F3N3O |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | (3S)-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-benzylpyrrolidin-3-amine |
| SMILES | FC(F)(F)c1ccc2c(c1)[C@H]1O[C@@H](CN[C@H]3CCN(Cc4ccccc4)C3)CC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C31H34F3N3O/c32-31(33,34)23-11-14-28-27(17-23)30-26(29(36-28)22-9-5-2-6-10-22)13-12-25(38-30)18-35-24-15-16-37(20-24)19-21-7-3-1-4-8-21/h1-11,14,17,24-26,29-30,35-36H,12-13,15-16,18-20H2/t24-,25+,26-,29-,30-/m0/s1 |
| InChIKey | MMGCXUIFXDMJGG-GJDJGZIVSA-N |
| XLogP | 6.57 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |