C30H38F3N3O2 — CID 59778038
1-[1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-yl]piperidin-3-ol (PubChem CID 59778038) has the molecular formula C30H38F3N3O2 and a molecular weight of 529.65 g/mol. Its IUPAC name is 1-[1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-yl]piperidin-3-ol.
| Compound Name | 1-[1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 59778038 |
| Molecular Formula | C30H38F3N3O2 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | 1-[1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-yl]piperidin-3-ol |
| SMILES | OC1CCCN(C2CCN(C[C@H]3CC[C@@H]4[C@H](O3)c3cc(C(F)(F)F)ccc3N[C@H]4c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C30H38F3N3O2/c31-30(32,33)21-8-11-27-26(17-21)29-25(28(34-27)20-5-2-1-3-6-20)10-9-24(38-29)19-35-15-12-22(13-16-35)36-14-4-7-23(37)18-36/h1-3,5-6,8,11,17,22-25,28-29,34,37H,4,7,9-10,12-16,18-19H2/t23?,24-,25+,28+,29+/m1/s1 |
| InChIKey | MCKVHEFZWLHPMO-VQRAJRRASA-N |
| XLogP | 5.63 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |