C31H33F3N2O — CID 59778061
(2R,4aS,5R,10bS)-5-phenyl-2-[(4-phenylpiperidin-1-yl)methyl]-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 59778061) has the molecular formula C31H33F3N2O and a molecular weight of 506.61 g/mol. Its IUPAC name is (2R,4aS,5R,10bS)-5-phenyl-2-[(4-phenylpiperidin-1-yl)methyl]-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (2R,4aS,5R,10bS)-5-phenyl-2-[(4-phenylpiperidin-1-yl)methyl]-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 59778061 |
| Molecular Formula | C31H33F3N2O |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | (2R,4aS,5R,10bS)-5-phenyl-2-[(4-phenylpiperidin-1-yl)methyl]-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | FC(F)(F)c1ccc2c(c1)[C@H]1O[C@@H](CN3CCC(c4ccccc4)CC3)CC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C31H33F3N2O/c32-31(33,34)24-11-14-28-27(19-24)30-26(29(35-28)23-9-5-2-6-10-23)13-12-25(37-30)20-36-17-15-22(16-18-36)21-7-3-1-4-8-21/h1-11,14,19,22,25-26,29-30,35H,12-13,15-18,20H2/t25-,26+,29+,30+/m1/s1 |
| InChIKey | DZROOIPIDKPFOC-UUHGVMMKSA-N |
| XLogP | 7.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |