C29H31F3N2O2S — CID 59778062
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-thiophen-2-ylpiperidin-4-ol (PubChem CID 59778062) has the molecular formula C29H31F3N2O2S and a molecular weight of 528.64 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-thiophen-2-ylpiperidin-4-ol.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-thiophen-2-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 59778062 |
| Molecular Formula | C29H31F3N2O2S |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-4-thiophen-2-ylpiperidin-4-ol |
| SMILES | OC1(c2cccs2)CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C29H31F3N2O2S/c30-29(31,32)20-8-11-24-23(17-20)27-22(26(33-24)19-5-2-1-3-6-19)10-9-21(36-27)18-34-14-12-28(35,13-15-34)25-7-4-16-37-25/h1-8,11,16-17,21-22,26-27,33,35H,9-10,12-15,18H2/t21-,22+,26+,27+/m1/s1 |
| InChIKey | MXGBRVISFRBBSH-SEEQBUNISA-N |
| XLogP | 6.75 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |