C27H35F3N4O4S — CID 59778071
N-[2-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylsulfamoyl]propylamino]ethyl]acetamide (PubChem CID 59778071) has the molecular formula C27H35F3N4O4S and a molecular weight of 568.66 g/mol. Its IUPAC name is N-[2-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylsulfamoyl]propylamino]ethyl]acetamide.
| Compound Name | N-[2-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylsulfamoyl]propylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 59778071 |
| Molecular Formula | C27H35F3N4O4S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | N-[2-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylsulfamoyl]propylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCCCS(=O)(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H35F3N4O4S/c1-18(35)32-14-13-31-12-5-15-39(36,37)33-17-21-9-10-22-25(19-6-3-2-4-7-19)34-24-11-8-20(27(28,29)30)16-23(24)26(22)38-21/h2-4,6-8,11,16,21-22,25-26,31,33-34H,5,9-10,12-15,17H2,1H3,(H,32,35)/t21-,22+,25+,26+/m1/s1 |
| InChIKey | KDPSLZRTYVIWJO-HRHCJDDBSA-N |
| XLogP | 3.74 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|