C9H15NO3 — CID 59778322
(3R,5S)-5-acetyl-1-methylpiperidine-3-carboxylic acid (PubChem CID 59778322) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (3R,5S)-5-acetyl-1-methylpiperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-5-acetyl-1-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 59778322 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (3R,5S)-5-acetyl-1-methylpiperidine-3-carboxylic acid |
| SMILES | CC(=O)[C@H]1C[C@@H](C(=O)O)CN(C)C1 |
| InChI | InChI=1S/C9H15NO3/c1-6(11)7-3-8(9(12)13)5-10(2)4-7/h7-8H,3-5H2,1-2H3,(H,12,13)/t7-,8+/m0/s1 |
| InChIKey | MZXBYTUIPOPPQV-JGVFFNPUSA-N |
| XLogP | 0.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |