C22H36O8 — CID 5977862
Bis(2-ethylbutyl) 2,9-dimethyl-4,7-dioxo-3,8-dioxadec-5-enedioate (PubChem CID 5977862) has the molecular formula C22H36O8 and a molecular weight of 428.50 g/mol. Its IUPAC name is bis[1-(2-ethylbutoxy)-1-oxopropan-2-yl] (E)-but-2-enedioate.
| Compound Name | Bis(2-ethylbutyl) 2,9-dimethyl-4,7-dioxo-3,8-dioxadec-5-enedioate |
|---|---|
| PubChem CID | 5977862 |
| Molecular Formula | C22H36O8 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | bis[1-(2-ethylbutoxy)-1-oxopropan-2-yl] (E)-but-2-enedioate |
| SMILES | CCC(CC)COC(=O)C(C)OC(=O)/C=C/C(=O)OC(C)C(=O)OCC(CC)CC |
| InChI | InChI=1S/C22H36O8/c1-7-17(8-2)13-27-21(25)15(5)29-19(23)11-12-20(24)30-16(6)22(26)28-14-18(9-3)10-4/h11-12,15-18H,7-10,13-14H2,1-6H3/b12-11+ |
| InChIKey | JDNFHJFHGNMHFC-VAWYXSNFSA-N |
| XLogP | 4.90 |
| TPSA | 105.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | 526 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|