C6H9N5O3 — CID 597792
3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanehydrazide (PubChem CID 597792) has the molecular formula C6H9N5O3 and a molecular weight of 199.17 g/mol. Its IUPAC name is 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanehydrazide.
| Compound Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanehydrazide |
|---|---|
| PubChem CID | 597792 |
| Molecular Formula | C6H9N5O3 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanehydrazide |
| SMILES | NNC(=O)CCc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H9N5O3/c7-9-4(12)2-1-3-5(13)8-6(14)11-10-3/h1-2,7H2,(H,9,12)(H2,8,11,13,14) |
| InChIKey | KNFUIGJWAGGIPP-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|