C14H18F9NO — CID 59779563
2-methyl-N-(7,7,8,8,9,9,10,10,10-nonafluorodecyl)prop-2-enamide (PubChem CID 59779563) has the molecular formula C14H18F9NO and a molecular weight of 387.29 g/mol. Its IUPAC name is 2-methyl-N-(7,7,8,8,9,9,10,10,10-nonafluorodecyl)prop-2-enamide.
| Compound Name | 2-methyl-N-(7,7,8,8,9,9,10,10,10-nonafluorodecyl)prop-2-enamide |
|---|---|
| PubChem CID | 59779563 |
| Molecular Formula | C14H18F9NO |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-methyl-N-(7,7,8,8,9,9,10,10,10-nonafluorodecyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H18F9NO/c1-9(2)10(25)24-8-6-4-3-5-7-11(15,16)12(17,18)13(19,20)14(21,22)23/h1,3-8H2,2H3,(H,24,25) |
| InChIKey | QMOSPZVMHHUPAD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|