About 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate
2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate (PubChem CID 59779744) has the molecular formula C13H25NO6S
and a molecular weight of 323.41 g/mol. Its IUPAC name is 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate |
| PubChem CID | 59779744 |
| Molecular Formula | C13H25NO6S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate |
| SMILES | COCC(C)(COC)C(=O)OCCN1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H25NO6S/c1-13(10-18-2,11-19-3)12(15)20-8-7-14-6-4-5-9-21(14,16)17/h4-11H2,1-3H3 |
| InChIKey | WKJATIPKYMXFOW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate?
The IUPAC name of 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate (CID 59779744) is 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate.
What is the SMILES notation for 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate?
The canonical SMILES for 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate is COCC(C)(COC)C(=O)OCCN1CCCCS1(=O)=O.
What is the InChIKey of 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate?
The InChIKey is WKJATIPKYMXFOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO6S/c1-13(10-18-2,11-19-3)12(15)20-8-7-14-6-4-5-9-21(14,16)17/h4-11H2,1-3H3.
What are the key properties of 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate?
2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate has a molecular weight of 323.41 g/mol, XLogP of 0.25, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiazinan-2-yl)ethyl 3-methoxy-2-(methoxymethyl)-2-methylpropanoate is sourced from PubChem (CID 59779744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).