About 2-chloro-N,N-diethylaniline
2-chloro-N,N-diethylaniline (PubChem CID 597798) has the molecular formula C10H14ClN
and a molecular weight of 183.68 g/mol. Its IUPAC name is 2-chloro-N,N-diethylaniline.
Molecular Properties
| Compound Name | 2-chloro-N,N-diethylaniline |
| PubChem CID | 597798 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-chloro-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccccc1Cl |
| InChI | InChI=1S/C10H14ClN/c1-3-12(4-2)10-8-6-5-7-9(10)11/h5-8H,3-4H2,1-2H3 |
| InChIKey | OQRCDIPTOADXMP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-diethylaniline?
The IUPAC name of 2-chloro-N,N-diethylaniline (CID 597798) is 2-chloro-N,N-diethylaniline.
What is the SMILES notation for 2-chloro-N,N-diethylaniline?
The canonical SMILES for 2-chloro-N,N-diethylaniline is CCN(CC)c1ccccc1Cl.
What is the InChIKey of 2-chloro-N,N-diethylaniline?
The InChIKey is OQRCDIPTOADXMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN/c1-3-12(4-2)10-8-6-5-7-9(10)11/h5-8H,3-4H2,1-2H3.
What are the key properties of 2-chloro-N,N-diethylaniline?
2-chloro-N,N-diethylaniline has a molecular weight of 183.68 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-diethylaniline is sourced from PubChem (CID 597798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).