C20H42O6Si4 — CID 59779958
3-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59779958) has the molecular formula C20H42O6Si4 and a molecular weight of 490.89 g/mol. Its IUPAC name is 3-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 3-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59779958 |
| Molecular Formula | C20H42O6Si4 |
| Molecular Weight | 490.89 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 3-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OCCC[Si]3(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O3)C(C2)C1C |
| InChI | InChI=1S/C20H42O6Si4/c1-15-16(2)18-13-17(15)14-19(18)20(21)22-11-10-12-30(9)25-28(5,6)23-27(3,4)24-29(7,8)26-30/h15-19H,10-14H2,1-9H3 |
| InChIKey | CUCKEQJMJKQLCA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.89 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|