C32H37ClN6O4S — CID 59780594
(3S)-7-[2-[2-chloro-5-[5-methylsulfonyl-1-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]ethynyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 59780594) has the molecular formula C32H37ClN6O4S and a molecular weight of 637.21 g/mol. Its IUPAC name is (3S)-7-[2-[2-chloro-5-[5-methylsulfonyl-1-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]ethynyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3S)-7-[2-[2-chloro-5-[5-methylsulfonyl-1-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]ethynyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 59780594 |
| Molecular Formula | C32H37ClN6O4S |
| Molecular Weight | 637.21 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | (3S)-7-[2-[2-chloro-5-[5-methylsulfonyl-1-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]ethynyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCc2c(c(-c3ccc(Cl)c(C#Cc4ccc5c(c4)CN[C@H](C(N)=O)C5)c3)nn2CCCN2CCOCC2)C1 |
| InChI | InChI=1S/C32H37ClN6O4S/c1-44(41,42)38-12-9-30-27(21-38)31(36-39(30)11-2-10-37-13-15-43-16-14-37)25-7-8-28(33)24(18-25)6-4-22-3-5-23-19-29(32(34)40)35-20-26(23)17-22/h3,5,7-8,17-18,29,35H,2,9-16,19-21H2,1H3,(H2,34,40)/t29-/m0/s1 |
| InChIKey | QANDVJCGMMKVDS-LJAQVGFWSA-N |
| XLogP | 2.14 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|