C35H49N2O+ — CID 59780756
4-[(3,5-dimethylbenzoyl)-[(3,5-dimethylphenyl)methyl]amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium (PubChem CID 59780756) has the molecular formula C35H49N2O+ and a molecular weight of 513.79 g/mol. Its IUPAC name is 4-[(3,5-dimethylbenzoyl)-[(3,5-dimethylphenyl)methyl]amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium.
| Compound Name | 4-[(3,5-dimethylbenzoyl)-[(3,5-dimethylphenyl)methyl]amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium |
|---|---|
| PubChem CID | 59780756 |
| Molecular Formula | C35H49N2O+ |
| Molecular Weight | 513.79 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | 4-[(3,5-dimethylbenzoyl)-[(3,5-dimethylphenyl)methyl]amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium |
| SMILES | CC[N+](CC)(CCCCN(Cc1cc(C)cc(C)c1)C(=O)c1cc(C)cc(C)c1)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C35H49N2O/c1-9-37(10-2,25-33-20-28(5)16-29(6)21-33)14-12-11-13-36(24-32-18-26(3)15-27(4)19-32)35(38)34-22-30(7)17-31(8)23-34/h15-23H,9-14,24-25H2,1-8H3/q+1 |
| InChIKey | PDZADCIYDBFCPK-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.79 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|