About (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal
(3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal (PubChem CID 59781122) has the molecular formula C13H11FO3
and a molecular weight of 234.23 g/mol. Its IUPAC name is (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal.
Molecular Properties
| Compound Name | (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal |
| PubChem CID | 59781122 |
| Molecular Formula | C13H11FO3 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal |
| SMILES | O=CC[C@@H](CF)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H11FO3/c14-7-8(5-6-15)11-12(16)9-3-1-2-4-10(9)13(11)17/h1-4,6,8,11H,5,7H2/t8-/m0/s1 |
| InChIKey | VWFRLORLTGDSQA-QMMMGPOBSA-N |
| XLogP | 1.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal?
The IUPAC name of (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal (CID 59781122) is (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal.
What is the SMILES notation for (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal?
The canonical SMILES for (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal is O=CC[C@@H](CF)C1C(=O)c2ccccc2C1=O.
What is the InChIKey of (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal?
The InChIKey is VWFRLORLTGDSQA-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H11FO3/c14-7-8(5-6-15)11-12(16)9-3-1-2-4-10(9)13(11)17/h1-4,6,8,11H,5,7H2/t8-/m0/s1.
What are the key properties of (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal?
(3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal has a molecular weight of 234.23 g/mol, XLogP of 1.86, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(1,3-dioxoinden-2-yl)-4-fluorobutanal is sourced from PubChem (CID 59781122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).