C20H18Cl2N4O2 — CID 59781565
4-(3-chloro-2-pyridinyl)-N-(6-chloro-3-pyridinyl)-2-(2-methoxyethylamino)benzamide (PubChem CID 59781565) has the molecular formula C20H18Cl2N4O2 and a molecular weight of 417.30 g/mol. Its IUPAC name is 4-(3-chloro-2-pyridinyl)-N-(6-chloro-3-pyridinyl)-2-(2-methoxyethylamino)benzamide.
| Compound Name | 4-(3-chloro-2-pyridinyl)-N-(6-chloro-3-pyridinyl)-2-(2-methoxyethylamino)benzamide |
|---|---|
| PubChem CID | 59781565 |
| Molecular Formula | C20H18Cl2N4O2 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 4-(3-chloro-2-pyridinyl)-N-(6-chloro-3-pyridinyl)-2-(2-methoxyethylamino)benzamide |
| SMILES | COCCNc1cc(-c2ncccc2Cl)ccc1C(=O)Nc1ccc(Cl)nc1 |
| InChI | InChI=1S/C20H18Cl2N4O2/c1-28-10-9-23-17-11-13(19-16(21)3-2-8-24-19)4-6-15(17)20(27)26-14-5-7-18(22)25-12-14/h2-8,11-12,23H,9-10H2,1H3,(H,26,27) |
| InChIKey | DVZXDTGHYCPCEN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|