C21H22F5NO3 — CID 59781861
3-[[6-(4,4,5,5,5-pentafluoropentoxy)naphthalen-2-yl]methylamino]cyclobutane-1-carboxylic acid (PubChem CID 59781861) has the molecular formula C21H22F5NO3 and a molecular weight of 431.40 g/mol. Its IUPAC name is 3-[[6-(4,4,5,5,5-pentafluoropentoxy)naphthalen-2-yl]methylamino]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[[6-(4,4,5,5,5-pentafluoropentoxy)naphthalen-2-yl]methylamino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 59781861 |
| Molecular Formula | C21H22F5NO3 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[[6-(4,4,5,5,5-pentafluoropentoxy)naphthalen-2-yl]methylamino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(NCc2ccc3cc(OCCCC(F)(F)C(F)(F)F)ccc3c2)C1 |
| InChI | InChI=1S/C21H22F5NO3/c22-20(23,21(24,25)26)6-1-7-30-18-5-4-14-8-13(2-3-15(14)11-18)12-27-17-9-16(10-17)19(28)29/h2-5,8,11,16-17,27H,1,6-7,9-10,12H2,(H,28,29) |
| InChIKey | SGMJXQHDYHUFHL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|