C14H28N2 — CID 59782158
(Z)-N,N,2,2,6,6-hexamethyl-5-methyliminohept-3-en-3-amine (PubChem CID 59782158) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is (Z)-N,N,2,2,6,6-hexamethyl-5-methyliminohept-3-en-3-amine.
| Compound Name | (Z)-N,N,2,2,6,6-hexamethyl-5-methyliminohept-3-en-3-amine |
|---|---|
| PubChem CID | 59782158 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (Z)-N,N,2,2,6,6-hexamethyl-5-methyliminohept-3-en-3-amine |
| SMILES | C/N=C(/C=C(\N(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28N2/c1-13(2,3)11(15-7)10-12(16(8)9)14(4,5)6/h10H,1-9H3/b12-10-,15-11- |
| InChIKey | XXGITILAACIXEB-KQWKDUQZSA-N |
| XLogP | 3.59 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|