About (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine
(Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine (PubChem CID 59782172) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine.
Molecular Properties
| Compound Name | (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine |
| PubChem CID | 59782172 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine |
| SMILES | C/N=C(\C=C(\C)OC)C(C)(C)C |
| InChI | InChI=1S/C10H19NO/c1-8(12-6)7-9(11-5)10(2,3)4/h7H,1-6H3/b8-7-,11-9+ |
| InChIKey | XWMXZXKGMZATBU-NSXXKTIASA-N |
| XLogP | 2.65 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine?
The IUPAC name of (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine (CID 59782172) is (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine.
What is the SMILES notation for (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine?
The canonical SMILES for (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine is C/N=C(\C=C(\C)OC)C(C)(C)C.
What is the InChIKey of (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine?
The InChIKey is XWMXZXKGMZATBU-NSXXKTIASA-N. The full InChI is InChI=1S/C10H19NO/c1-8(12-6)7-9(11-5)10(2,3)4/h7H,1-6H3/b8-7-,11-9+.
What are the key properties of (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine?
(Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine has a molecular weight of 169.27 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-methoxy-N,2,2-trimethylhex-4-en-3-imine is sourced from PubChem (CID 59782172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).