C12H2F9NOS — CID 59782189
2,5,7-tris(trifluoromethyl)furo[3,2-e][1,3]benzothiazole (PubChem CID 59782189) has the molecular formula C12H2F9NOS and a molecular weight of 379.20 g/mol. Its IUPAC name is 2,5,7-tris(trifluoromethyl)furo[3,2-e][1,3]benzothiazole.
| Compound Name | 2,5,7-tris(trifluoromethyl)furo[3,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 59782189 |
| Molecular Formula | C12H2F9NOS |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 2,5,7-tris(trifluoromethyl)furo[3,2-e][1,3]benzothiazole |
| SMILES | FC(F)(F)c1cc2c(o1)c(C(F)(F)F)cc1sc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C12H2F9NOS/c13-10(14,15)4-2-5-7(22-9(24-5)12(19,20)21)3-1-6(11(16,17)18)23-8(3)4/h1-2H |
| InChIKey | IDWGCRLSIHGZIR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |