C12H11NS2 — CID 59782205
2,5,7-trimethylthieno[3,2-e][1,3]benzothiazole (PubChem CID 59782205) has the molecular formula C12H11NS2 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2,5,7-trimethylthieno[3,2-e][1,3]benzothiazole.
| Compound Name | 2,5,7-trimethylthieno[3,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 59782205 |
| Molecular Formula | C12H11NS2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 2,5,7-trimethylthieno[3,2-e][1,3]benzothiazole |
| SMILES | Cc1cc2c(s1)c(C)cc1sc(C)nc12 |
| InChI | InChI=1S/C12H11NS2/c1-6-4-10-11(13-8(3)15-10)9-5-7(2)14-12(6)9/h4-5H,1-3H3 |
| InChIKey | DRWTXDAUNXHXDC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |